C10H11N3OS — CID 58957158
N-(1H-benzimidazol-2-ylmethyl)-2-sulfanylacetamide (PubChem CID 58957158) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-2-sulfanylacetamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 58957158 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-2-sulfanylacetamide |
| SMILES | O=C(CS)NCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H11N3OS/c14-10(6-15)11-5-9-12-7-3-1-2-4-8(7)13-9/h1-4,15H,5-6H2,(H,11,14)(H,12,13) |
| InChIKey | IKZQNQHRYUDFKI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|