C13H18N4O — CID 113223965
3-(1H-benzimidazol-2-ylmethyl)-1,1-diethylurea (PubChem CID 113223965) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-ylmethyl)-1,1-diethylurea.
| Compound Name | 3-(1H-benzimidazol-2-ylmethyl)-1,1-diethylurea |
|---|---|
| PubChem CID | 113223965 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-(1H-benzimidazol-2-ylmethyl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H18N4O/c1-3-17(4-2)13(18)14-9-12-15-10-7-5-6-8-11(10)16-12/h5-8H,3-4,9H2,1-2H3,(H,14,18)(H,15,16) |
| InChIKey | HVEMQHWJVFRLMI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |