C9H11N5S — CID 13291870
1-amino-3-(1H-benzimidazol-2-ylmethyl)thiourea (PubChem CID 13291870) has the molecular formula C9H11N5S and a molecular weight of 221.29 g/mol. Its IUPAC name is 1-amino-3-(1H-benzimidazol-2-ylmethyl)thiourea.
| Compound Name | 1-amino-3-(1H-benzimidazol-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 13291870 |
| Molecular Formula | C9H11N5S |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 1-amino-3-(1H-benzimidazol-2-ylmethyl)thiourea |
| SMILES | NNC(=S)NCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H11N5S/c10-14-9(15)11-5-8-12-6-3-1-2-4-7(6)13-8/h1-4H,5,10H2,(H,12,13)(H2,11,14,15) |
| InChIKey | WBYKHKMYFBMPLO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|