C10H14N4 — CID 15365342
N'-(1H-benzimidazol-2-ylmethyl)ethane-1,2-diamine (PubChem CID 15365342) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is N'-(1H-benzimidazol-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(1H-benzimidazol-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 15365342 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | N'-(1H-benzimidazol-2-ylmethyl)ethane-1,2-diamine |
| SMILES | NCCNCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H14N4/c11-5-6-12-7-10-13-8-3-1-2-4-9(8)14-10/h1-4,12H,5-7,11H2,(H,13,14) |
| InChIKey | GAFURNQZXPTIJY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|