C12H15N3 — CID 43655401
N-(1H-benzimidazol-2-ylmethyl)-1-cyclopropylmethanamine (PubChem CID 43655401) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-1-cyclopropylmethanamine.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-1-cyclopropylmethanamine |
|---|---|
| PubChem CID | 43655401 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-1-cyclopropylmethanamine |
| SMILES | c1ccc2[nH]c(CNCC3CC3)nc2c1 |
| InChI | InChI=1S/C12H15N3/c1-2-4-11-10(3-1)14-12(15-11)8-13-7-9-5-6-9/h1-4,9,13H,5-8H2,(H,14,15) |
| InChIKey | JJLIHRDOQCCYFG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |