C15H19N3 — CID 78991581
N-(1H-benzimidazol-2-ylmethyl)-1,1-dicyclopropylmethanamine (PubChem CID 78991581) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-1,1-dicyclopropylmethanamine.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-1,1-dicyclopropylmethanamine |
|---|---|
| PubChem CID | 78991581 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-1,1-dicyclopropylmethanamine |
| SMILES | c1ccc2[nH]c(CNC(C3CC3)C3CC3)nc2c1 |
| InChI | InChI=1S/C15H19N3/c1-2-4-13-12(3-1)17-14(18-13)9-16-15(10-5-6-10)11-7-8-11/h1-4,10-11,15-16H,5-9H2,(H,17,18) |
| InChIKey | XYCDEPAFXHZIFV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |