C15H13ClN4S — CID 13196115
1-(1H-benzimidazol-2-ylmethyl)-3-(3-chlorophenyl)thiourea (PubChem CID 13196115) has the molecular formula C15H13ClN4S and a molecular weight of 316.82 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-ylmethyl)-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-(1H-benzimidazol-2-ylmethyl)-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 13196115 |
| Molecular Formula | C15H13ClN4S |
| Molecular Weight | 316.82 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 1-(1H-benzimidazol-2-ylmethyl)-3-(3-chlorophenyl)thiourea |
| SMILES | S=C(NCc1nc2ccccc2[nH]1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13ClN4S/c16-10-4-3-5-11(8-10)18-15(21)17-9-14-19-12-6-1-2-7-13(12)20-14/h1-8H,9H2,(H,19,20)(H2,17,18,21) |
| InChIKey | PKLHUDGJJRIQJT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|