C17H17N5OS — CID 3061161
1-[[2-(1H-benzimidazol-2-yl)acetyl]amino]-3-(3-methylphenyl)thiourea (PubChem CID 3061161) has the molecular formula C17H17N5OS and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-[[2-(1H-benzimidazol-2-yl)acetyl]amino]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[[2-(1H-benzimidazol-2-yl)acetyl]amino]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 3061161 |
| Molecular Formula | C17H17N5OS |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-[[2-(1H-benzimidazol-2-yl)acetyl]amino]-3-(3-methylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)NNC(=O)Cc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C17H17N5OS/c1-11-5-4-6-12(9-11)18-17(24)22-21-16(23)10-15-19-13-7-2-3-8-14(13)20-15/h2-9H,10H2,1H3,(H,19,20)(H,21,23)(H2,18,22,24) |
| InChIKey | GYYQPDOVALHNRG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|