C19H19ClN4O2 — CID 173339592
2-(1H-benzimidazol-2-yl)-N'-(3-oxo-1-phenylbut-1-enyl)acetohydrazide;hydrochloride (PubChem CID 173339592) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-N'-(3-oxo-1-phenylbut-1-enyl)acetohydrazide;hydrochloride.
| Compound Name | 2-(1H-benzimidazol-2-yl)-N'-(3-oxo-1-phenylbut-1-enyl)acetohydrazide;hydrochloride |
|---|---|
| PubChem CID | 173339592 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-N'-(3-oxo-1-phenylbut-1-enyl)acetohydrazide;hydrochloride |
| SMILES | CC(=O)C=C(NNC(=O)Cc1nc2ccccc2[nH]1)c1ccccc1.Cl |
| InChI | InChI=1S/C19H18N4O2.ClH/c1-13(24)11-17(14-7-3-2-4-8-14)22-23-19(25)12-18-20-15-9-5-6-10-16(15)21-18;/h2-11,22H,12H2,1H3,(H,20,21)(H,23,25);1H |
| InChIKey | VQENCYCXQXSFMX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|