C13H11N3OS — CID 751095
N-(1H-benzimidazol-2-ylmethyl)thiophene-2-carboxamide (PubChem CID 751095) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)thiophene-2-carboxamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 751095 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCc1nc2ccccc2[nH]1)c1cccs1 |
| InChI | InChI=1S/C13H11N3OS/c17-13(11-6-3-7-18-11)14-8-12-15-9-4-1-2-5-10(9)16-12/h1-7H,8H2,(H,14,17)(H,15,16) |
| InChIKey | HEPYZVOFXYSVGR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |