C12H5ClO5 — CID 54705919
9-chloro-4-hydroxypyrano[3,2-c]chromene-2,5-dione (PubChem CID 54705919) has the molecular formula C12H5ClO5 and a molecular weight of 264.62 g/mol. Its IUPAC name is 9-chloro-4-hydroxypyrano[3,2-c]chromene-2,5-dione.
| Compound Name | 9-chloro-4-hydroxypyrano[3,2-c]chromene-2,5-dione |
|---|---|
| PubChem CID | 54705919 |
| Molecular Formula | C12H5ClO5 |
| Molecular Weight | 264.62 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 9-chloro-4-hydroxypyrano[3,2-c]chromene-2,5-dione |
| SMILES | O=c1cc(O)c2c(=O)oc3ccc(Cl)cc3c2o1 |
| InChI | InChI=1S/C12H5ClO5/c13-5-1-2-8-6(3-5)11-10(12(16)17-8)7(14)4-9(15)18-11/h1-4,14H |
| InChIKey | KQWBWFPZNHMQJR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.62 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|