C15H6ClFO5 — CID 132547250
2-chloro-10-fluoro-8,9-dihydroxy-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 132547250) has the molecular formula C15H6ClFO5 and a molecular weight of 320.66 g/mol. Its IUPAC name is 2-chloro-10-fluoro-8,9-dihydroxy-[1]benzofuro[3,2-c]chromen-6-one.
| Compound Name | 2-chloro-10-fluoro-8,9-dihydroxy-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 132547250 |
| Molecular Formula | C15H6ClFO5 |
| Molecular Weight | 320.66 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 2-chloro-10-fluoro-8,9-dihydroxy-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | O=c1oc2ccc(Cl)cc2c2oc3c(F)c(O)c(O)cc3c12 |
| InChI | InChI=1S/C15H6ClFO5/c16-5-1-2-9-6(3-5)13-10(15(20)21-9)7-4-8(18)12(19)11(17)14(7)22-13/h1-4,18-19H |
| InChIKey | AMKIELNGAAODHG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|