C15H7BrO5 — CID 42600759
2-bromo-3,9-dihydroxy-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 42600759) has the molecular formula C15H7BrO5 and a molecular weight of 347.12 g/mol. Its IUPAC name is 2-bromo-3,9-dihydroxy-[1]benzofuro[3,2-c]chromen-6-one.
| Compound Name | 2-bromo-3,9-dihydroxy-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 42600759 |
| Molecular Formula | C15H7BrO5 |
| Molecular Weight | 347.12 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | 2-bromo-3,9-dihydroxy-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | O=c1oc2cc(O)c(Br)cc2c2oc3cc(O)ccc3c12 |
| InChI | InChI=1S/C15H7BrO5/c16-9-4-8-12(5-10(9)18)21-15(19)13-7-2-1-6(17)3-11(7)20-14(8)13/h1-5,17-18H |
| InChIKey | MQKPKXZWPDUNNK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.12 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|