C20H16O4 — CID 147944072
3-hydroxy-2-(3-methylbut-2-enyl)-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 147944072) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is 3-hydroxy-2-(3-methylbut-2-enyl)-[1]benzofuro[3,2-c]chromen-6-one.
| Compound Name | 3-hydroxy-2-(3-methylbut-2-enyl)-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 147944072 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 3-hydroxy-2-(3-methylbut-2-enyl)-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | CC(C)=CCc1cc2c(cc1O)oc(=O)c1c3ccccc3oc21 |
| InChI | InChI=1S/C20H16O4/c1-11(2)7-8-12-9-14-17(10-15(12)21)24-20(22)18-13-5-3-4-6-16(13)23-19(14)18/h3-7,9-10,21H,8H2,1-2H3 |
| InChIKey | JTELMABKSDJVSP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|