C24H21Cl2NO6 — CID 159214856
6-chloro-4-hydroxychromen-2-one;6-chloro-4-(piperidin-3-ylmethoxy)chromen-2-one (PubChem CID 159214856) has the molecular formula C24H21Cl2NO6 and a molecular weight of 490.34 g/mol. Its IUPAC name is 6-chloro-4-hydroxychromen-2-one;6-chloro-4-(piperidin-3-ylmethoxy)chromen-2-one.
| Compound Name | 6-chloro-4-hydroxychromen-2-one;6-chloro-4-(piperidin-3-ylmethoxy)chromen-2-one |
|---|---|
| PubChem CID | 159214856 |
| Molecular Formula | C24H21Cl2NO6 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 6-chloro-4-hydroxychromen-2-one;6-chloro-4-(piperidin-3-ylmethoxy)chromen-2-one |
| SMILES | O=c1cc(O)c2cc(Cl)ccc2o1.O=c1cc(OCC2CCCNC2)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C15H16ClNO3.C9H5ClO3/c16-11-3-4-13-12(6-11)14(7-15(18)20-13)19-9-10-2-1-5-17-8-10;10-5-1-2-8-6(3-5)7(11)4-9(12)13-8/h3-4,6-7,10,17H,1-2,5,8-9H2;1-4,11H |
| InChIKey | KQYAMDHLPWWTFN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|