C19H21Cl2NO3 — CID 24774733
(3S)-3-[[4-chloro-2-(4-chloro-2-methoxyphenoxy)phenoxy]methyl]piperidine (PubChem CID 24774733) has the molecular formula C19H21Cl2NO3 and a molecular weight of 382.29 g/mol. Its IUPAC name is (3S)-3-[[4-chloro-2-(4-chloro-2-methoxyphenoxy)phenoxy]methyl]piperidine.
| Compound Name | (3S)-3-[[4-chloro-2-(4-chloro-2-methoxyphenoxy)phenoxy]methyl]piperidine |
|---|---|
| PubChem CID | 24774733 |
| Molecular Formula | C19H21Cl2NO3 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (3S)-3-[[4-chloro-2-(4-chloro-2-methoxyphenoxy)phenoxy]methyl]piperidine |
| SMILES | COc1cc(Cl)ccc1Oc1cc(Cl)ccc1OC[C@H]1CCCNC1 |
| InChI | InChI=1S/C19H21Cl2NO3/c1-23-18-9-14(20)5-7-17(18)25-19-10-15(21)4-6-16(19)24-12-13-3-2-8-22-11-13/h4-7,9-10,13,22H,2-3,8,11-12H2,1H3/t13-/m0/s1 |
| InChIKey | UNRKDQGIVDAFSE-ZDUSSCGKSA-N |
| XLogP | 5.17 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |