C23H25ClFNO7 — CID 158543944
(E)-but-2-enedioic acid;(3S)-3-[[2-(4-chloro-2-methoxyphenoxy)-4-fluorophenoxy]methyl]piperidine (PubChem CID 158543944) has the molecular formula C23H25ClFNO7 and a molecular weight of 481.90 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(3S)-3-[[2-(4-chloro-2-methoxyphenoxy)-4-fluorophenoxy]methyl]piperidine.
| Compound Name | (E)-but-2-enedioic acid;(3S)-3-[[2-(4-chloro-2-methoxyphenoxy)-4-fluorophenoxy]methyl]piperidine |
|---|---|
| PubChem CID | 158543944 |
| Molecular Formula | C23H25ClFNO7 |
| Molecular Weight | 481.90 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (E)-but-2-enedioic acid;(3S)-3-[[2-(4-chloro-2-methoxyphenoxy)-4-fluorophenoxy]methyl]piperidine |
| SMILES | COc1cc(Cl)ccc1Oc1cc(F)ccc1OC[C@H]1CCCNC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H21ClFNO3.C4H4O4/c1-23-18-9-14(20)4-6-17(18)25-19-10-15(21)5-7-16(19)24-12-13-3-2-8-22-11-13;5-3(6)1-2-4(7)8/h4-7,9-10,13,22H,2-3,8,11-12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t13-;/m0./s1 |
| InChIKey | HOWHNFPCZJISJF-QDSMGTAFSA-N |
| XLogP | 4.37 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.90 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|