C17H18ClFN2O2 — CID 68596688
2-(2-chloro-4-fluorophenoxy)-3-(piperidin-3-ylmethoxy)pyridine (PubChem CID 68596688) has the molecular formula C17H18ClFN2O2 and a molecular weight of 336.79 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-3-(piperidin-3-ylmethoxy)pyridine.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-3-(piperidin-3-ylmethoxy)pyridine |
|---|---|
| PubChem CID | 68596688 |
| Molecular Formula | C17H18ClFN2O2 |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-3-(piperidin-3-ylmethoxy)pyridine |
| SMILES | Fc1ccc(Oc2ncccc2OCC2CCCNC2)c(Cl)c1 |
| InChI | InChI=1S/C17H18ClFN2O2/c18-14-9-13(19)5-6-15(14)23-17-16(4-2-8-21-17)22-11-12-3-1-7-20-10-12/h2,4-6,8-9,12,20H,1,3,7,10-11H2 |
| InChIKey | WTUDMDLYFRMHOV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |