C21H23FN2O6 — CID 158102057
(E)-but-2-enedioic acid;2-(4-fluorophenoxy)-3-[[(3R)-piperidin-3-yl]methoxy]pyridine (PubChem CID 158102057) has the molecular formula C21H23FN2O6 and a molecular weight of 418.42 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(4-fluorophenoxy)-3-[[(3R)-piperidin-3-yl]methoxy]pyridine.
| Compound Name | (E)-but-2-enedioic acid;2-(4-fluorophenoxy)-3-[[(3R)-piperidin-3-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 158102057 |
| Molecular Formula | C21H23FN2O6 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(4-fluorophenoxy)-3-[[(3R)-piperidin-3-yl]methoxy]pyridine |
| SMILES | Fc1ccc(Oc2ncccc2OC[C@@H]2CCCNC2)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H19FN2O2.C4H4O4/c18-14-5-7-15(8-6-14)22-17-16(4-2-10-20-17)21-12-13-3-1-9-19-11-13;5-3(6)1-2-4(7)8/h2,4-8,10,13,19H,1,3,9,11-12H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t13-;/m1./s1 |
| InChIKey | FPJPWFSZCOGCHZ-CSCOWPIISA-N |
| XLogP | 3.10 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|