C25H30N2O6 — CID 158492905
(E)-but-2-enedioic acid;2-(2,3-dihydro-1H-inden-5-yloxy)-6-methyl-3-[[(3S)-piperidin-3-yl]methoxy]pyridine (PubChem CID 158492905) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(2,3-dihydro-1H-inden-5-yloxy)-6-methyl-3-[[(3S)-piperidin-3-yl]methoxy]pyridine.
| Compound Name | (E)-but-2-enedioic acid;2-(2,3-dihydro-1H-inden-5-yloxy)-6-methyl-3-[[(3S)-piperidin-3-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 158492905 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(2,3-dihydro-1H-inden-5-yloxy)-6-methyl-3-[[(3S)-piperidin-3-yl]methoxy]pyridine |
| SMILES | Cc1ccc(OC[C@H]2CCCNC2)c(Oc2ccc3c(c2)CCC3)n1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H26N2O2.C4H4O4/c1-15-7-10-20(24-14-16-4-3-11-22-13-16)21(23-15)25-19-9-8-17-5-2-6-18(17)12-19;5-3(6)1-2-4(7)8/h7-10,12,16,22H,2-6,11,13-14H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t16-;/m0./s1 |
| InChIKey | HIXNWYDNTHOQAB-SBWPJONASA-N |
| XLogP | 3.76 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|