C24H30N2O7 — CID 158162824
(E)-but-2-enedioic acid;3-[[(3S)-piperidin-3-yl]methoxy]-2-(2-propan-2-yloxyphenoxy)pyridine (PubChem CID 158162824) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-[[(3S)-piperidin-3-yl]methoxy]-2-(2-propan-2-yloxyphenoxy)pyridine.
| Compound Name | (E)-but-2-enedioic acid;3-[[(3S)-piperidin-3-yl]methoxy]-2-(2-propan-2-yloxyphenoxy)pyridine |
|---|---|
| PubChem CID | 158162824 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (E)-but-2-enedioic acid;3-[[(3S)-piperidin-3-yl]methoxy]-2-(2-propan-2-yloxyphenoxy)pyridine |
| SMILES | CC(C)Oc1ccccc1Oc1ncccc1OC[C@H]1CCCNC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H26N2O3.C4H4O4/c1-15(2)24-17-8-3-4-9-18(17)25-20-19(10-6-12-22-20)23-14-16-7-5-11-21-13-16;5-3(6)1-2-4(7)8/h3-4,6,8-10,12,15-16,21H,5,7,11,13-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t16-;/m0./s1 |
| InChIKey | FWMGTDLLYZRABE-SBWPJONASA-N |
| XLogP | 3.75 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|