C18H22N2O2 — CID 68595656
2-(3-methylphenoxy)-3-(piperidin-3-ylmethoxy)pyridine (PubChem CID 68595656) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-(3-methylphenoxy)-3-(piperidin-3-ylmethoxy)pyridine.
| Compound Name | 2-(3-methylphenoxy)-3-(piperidin-3-ylmethoxy)pyridine |
|---|---|
| PubChem CID | 68595656 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-(3-methylphenoxy)-3-(piperidin-3-ylmethoxy)pyridine |
| SMILES | Cc1cccc(Oc2ncccc2OCC2CCCNC2)c1 |
| InChI | InChI=1S/C18H22N2O2/c1-14-5-2-7-16(11-14)22-18-17(8-4-10-20-18)21-13-15-6-3-9-19-12-15/h2,4-5,7-8,10-11,15,19H,3,6,9,12-13H2,1H3 |
| InChIKey | ZBRWDSHOMHZMDW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |