C15H20Cl2N2O — CID 66523926
8-(piperidin-3-ylmethoxy)quinoline;dihydrochloride (PubChem CID 66523926) has the molecular formula C15H20Cl2N2O and a molecular weight of 315.24 g/mol. Its IUPAC name is 8-(piperidin-3-ylmethoxy)quinoline;dihydrochloride.
| Compound Name | 8-(piperidin-3-ylmethoxy)quinoline;dihydrochloride |
|---|---|
| PubChem CID | 66523926 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 8-(piperidin-3-ylmethoxy)quinoline;dihydrochloride |
| SMILES | Cl.Cl.c1cnc2c(OCC3CCCNC3)cccc2c1 |
| InChI | InChI=1S/C15H18N2O.2ClH/c1-5-13-6-3-9-17-15(13)14(7-1)18-11-12-4-2-8-16-10-12;;/h1,3,5-7,9,12,16H,2,4,8,10-11H2;2*1H |
| InChIKey | RLYMHDMAXNCERX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |