C23H28N2O6 — CID 162319685
(E)-but-2-enedioic acid;2-ethoxy-3-[[(3S,4R)-4-phenylpiperidin-3-yl]methoxy]pyridine (PubChem CID 162319685) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-ethoxy-3-[[(3S,4R)-4-phenylpiperidin-3-yl]methoxy]pyridine.
| Compound Name | (E)-but-2-enedioic acid;2-ethoxy-3-[[(3S,4R)-4-phenylpiperidin-3-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 162319685 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (E)-but-2-enedioic acid;2-ethoxy-3-[[(3S,4R)-4-phenylpiperidin-3-yl]methoxy]pyridine |
| SMILES | CCOc1ncccc1OC[C@@H]1CNCC[C@H]1c1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H24N2O2.C4H4O4/c1-2-22-19-18(9-6-11-21-19)23-14-16-13-20-12-10-17(16)15-7-4-3-5-8-15;5-3(6)1-2-4(7)8/h3-9,11,16-17,20H,2,10,12-14H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t16-,17-;/m0./s1 |
| InChIKey | YHQUFKVFXAIUNY-PDMJLPKPSA-N |
| XLogP | 2.96 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|