C21H26N2O3 — CID 69155626
3-methoxy-N-methyl-4-[[(3S,4R)-4-phenylpiperidin-3-yl]methoxy]benzamide (PubChem CID 69155626) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-methoxy-N-methyl-4-[[(3S,4R)-4-phenylpiperidin-3-yl]methoxy]benzamide.
| Compound Name | 3-methoxy-N-methyl-4-[[(3S,4R)-4-phenylpiperidin-3-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 69155626 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 3-methoxy-N-methyl-4-[[(3S,4R)-4-phenylpiperidin-3-yl]methoxy]benzamide |
| SMILES | CNC(=O)c1ccc(OC[C@@H]2CNCC[C@H]2c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C21H26N2O3/c1-22-21(24)16-8-9-19(20(12-16)25-2)26-14-17-13-23-11-10-18(17)15-6-4-3-5-7-15/h3-9,12,17-18,23H,10-11,13-14H2,1-2H3,(H,22,24)/t17-,18-/m0/s1 |
| InChIKey | HNWNUYBZKLKWAA-ROUUACIJSA-N |
| XLogP | 2.83 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |