C20H26N2O3 — CID 69156390
2-(2-methoxyethoxy)-3-[[(3R,4S)-4-phenylpiperidin-3-yl]methoxy]pyridine (PubChem CID 69156390) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-3-[[(3R,4S)-4-phenylpiperidin-3-yl]methoxy]pyridine.
| Compound Name | 2-(2-methoxyethoxy)-3-[[(3R,4S)-4-phenylpiperidin-3-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 69156390 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-(2-methoxyethoxy)-3-[[(3R,4S)-4-phenylpiperidin-3-yl]methoxy]pyridine |
| SMILES | COCCOc1ncccc1OC[C@H]1CNCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H26N2O3/c1-23-12-13-24-20-19(8-5-10-22-20)25-15-17-14-21-11-9-18(17)16-6-3-2-4-7-16/h2-8,10,17-18,21H,9,11-15H2,1H3/t17-,18-/m1/s1 |
| InChIKey | YWOJKSUKPYWJEY-QZTJIDSGSA-N |
| XLogP | 2.88 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|