About 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine
3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine (PubChem CID 126676929) has the molecular formula C26H30N2O3
and a molecular weight of 418.54 g/mol. Its IUPAC name is 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine.
Molecular Properties
| Compound Name | 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine |
| PubChem CID | 126676929 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine |
| SMILES | c1ccc(COCCOc2ccc([C@H]3CCNC[C@@H]3COc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C26H30N2O3/c1-2-5-21(6-3-1)19-29-15-16-30-24-10-8-22(9-11-24)26-12-14-28-17-23(26)20-31-25-7-4-13-27-18-25/h1-11,13,18,23,26,28H,12,14-17,19-20H2/t23-,26-/m1/s1 |
| InChIKey | WEBJRSLEBAJWAM-ZEQKJWHPSA-N |
| XLogP | 4.45 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine?
The IUPAC name of 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine (CID 126676929) is 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine.
What is the SMILES notation for 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine?
The canonical SMILES for 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine is c1ccc(COCCOc2ccc([C@H]3CCNC[C@@H]3COc3cccnc3)cc2)cc1.
What is the InChIKey of 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine?
The InChIKey is WEBJRSLEBAJWAM-ZEQKJWHPSA-N. The full InChI is InChI=1S/C26H30N2O3/c1-2-5-21(6-3-1)19-29-15-16-30-24-10-8-22(9-11-24)26-12-14-28-17-23(26)20-31-25-7-4-13-27-18-25/h1-11,13,18,23,26,28H,12,14-17,19-20H2/t23-,26-/m1/s1.
What are the key properties of 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine?
3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine has a molecular weight of 418.54 g/mol, XLogP of 4.45, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3R,4S)-4-[4-(2-phenylmethoxyethoxy)phenyl]piperidin-3-yl]methoxy]pyridine is sourced from PubChem (CID 126676929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).