C22H27ClFNO5 — CID 168915271
2-[2-[4-[[(3S,4R)-4-(4-fluorophenyl)piperidin-3-yl]methoxy]phenoxy]ethoxy]acetic acid;hydrochloride (PubChem CID 168915271) has the molecular formula C22H27ClFNO5 and a molecular weight of 439.91 g/mol. Its IUPAC name is 2-[2-[4-[[(3S,4R)-4-(4-fluorophenyl)piperidin-3-yl]methoxy]phenoxy]ethoxy]acetic acid;hydrochloride.
| Compound Name | 2-[2-[4-[[(3S,4R)-4-(4-fluorophenyl)piperidin-3-yl]methoxy]phenoxy]ethoxy]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 168915271 |
| Molecular Formula | C22H27ClFNO5 |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-[2-[4-[[(3S,4R)-4-(4-fluorophenyl)piperidin-3-yl]methoxy]phenoxy]ethoxy]acetic acid;hydrochloride |
| SMILES | Cl.O=C(O)COCCOc1ccc(OC[C@@H]2CNCC[C@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H26FNO5.ClH/c23-18-3-1-16(2-4-18)21-9-10-24-13-17(21)14-29-20-7-5-19(6-8-20)28-12-11-27-15-22(25)26;/h1-8,17,21,24H,9-15H2,(H,25,26);1H/t17-,21-;/m0./s1 |
| InChIKey | YFDVLHIMANOQQN-PVMVIUQGSA-N |
| XLogP | 3.50 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|