C31H37FN2O4 — CID 126676938
4-[[(3S,4R)-4-[4-[2-(4-fluorophenyl)ethoxy]phenyl]piperidin-3-yl]methoxy]-N-(3-methoxypropyl)benzamide (PubChem CID 126676938) has the molecular formula C31H37FN2O4 and a molecular weight of 520.65 g/mol. Its IUPAC name is 4-[[(3S,4R)-4-[4-[2-(4-fluorophenyl)ethoxy]phenyl]piperidin-3-yl]methoxy]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-[[(3S,4R)-4-[4-[2-(4-fluorophenyl)ethoxy]phenyl]piperidin-3-yl]methoxy]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 126676938 |
| Molecular Formula | C31H37FN2O4 |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 4-[[(3S,4R)-4-[4-[2-(4-fluorophenyl)ethoxy]phenyl]piperidin-3-yl]methoxy]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1ccc(OC[C@@H]2CNCC[C@H]2c2ccc(OCCc3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H37FN2O4/c1-36-19-2-17-34-31(35)25-7-13-29(14-8-25)38-22-26-21-33-18-15-30(26)24-5-11-28(12-6-24)37-20-16-23-3-9-27(32)10-4-23/h3-14,26,30,33H,2,15-22H2,1H3,(H,34,35)/t26-,30-/m0/s1 |
| InChIKey | OFCSSYTYBHPIAW-YZNIXAGQSA-N |
| XLogP | 4.99 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|