C25H34N2O4 — CID 126676925
4-[[(3S,4R)-4-[4-(2-methoxyethoxy)phenyl]piperidin-3-yl]methoxy]-N-propylbenzamide (PubChem CID 126676925) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 4-[[(3S,4R)-4-[4-(2-methoxyethoxy)phenyl]piperidin-3-yl]methoxy]-N-propylbenzamide.
| Compound Name | 4-[[(3S,4R)-4-[4-(2-methoxyethoxy)phenyl]piperidin-3-yl]methoxy]-N-propylbenzamide |
|---|---|
| PubChem CID | 126676925 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 4-[[(3S,4R)-4-[4-(2-methoxyethoxy)phenyl]piperidin-3-yl]methoxy]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(OC[C@@H]2CNCC[C@H]2c2ccc(OCCOC)cc2)cc1 |
| InChI | InChI=1S/C25H34N2O4/c1-3-13-27-25(28)20-6-10-23(11-7-20)31-18-21-17-26-14-12-24(21)19-4-8-22(9-5-19)30-16-15-29-2/h4-11,21,24,26H,3,12-18H2,1-2H3,(H,27,28)/t21-,24-/m0/s1 |
| InChIKey | CBHNXXQXGFVHIY-URXFXBBRSA-N |
| XLogP | 3.62 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|