About (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride
(3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride (PubChem CID 67842104) has the molecular formula C22H29ClFNO
and a molecular weight of 377.93 g/mol. Its IUPAC name is (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride.
Molecular Properties
| Compound Name | (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride |
| PubChem CID | 67842104 |
| Molecular Formula | C22H29ClFNO |
| Molecular Weight | 377.93 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride |
| SMILES | CC(C)(C)c1ccc(OC[C@@H]2CNCC[C@H]2c2ccc(F)cc2)cc1.Cl |
| InChI | InChI=1S/C22H28FNO.ClH/c1-22(2,3)18-6-10-20(11-7-18)25-15-17-14-24-13-12-21(17)16-4-8-19(23)9-5-16;/h4-11,17,21,24H,12-15H2,1-3H3;1H/t17-,21-;/m0./s1 |
| InChIKey | KTLFIRFDLNFRRU-PVMVIUQGSA-N |
| XLogP | 5.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.93 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride?
The IUPAC name of (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride (CID 67842104) is (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride.
What is the SMILES notation for (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride?
The canonical SMILES for (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride is CC(C)(C)c1ccc(OC[C@@H]2CNCC[C@H]2c2ccc(F)cc2)cc1.Cl.
What is the InChIKey of (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride?
The InChIKey is KTLFIRFDLNFRRU-PVMVIUQGSA-N. The full InChI is InChI=1S/C22H28FNO.ClH/c1-22(2,3)18-6-10-20(11-7-18)25-15-17-14-24-13-12-21(17)16-4-8-19(23)9-5-16;/h4-11,17,21,24H,12-15H2,1-3H3;1H/t17-,21-;/m0./s1.
What are the key properties of (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride?
(3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride has a molecular weight of 377.93 g/mol, XLogP of 5.32, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3-[(4-tert-butylphenoxy)methyl]-4-(4-fluorophenyl)piperidine;hydrochloride is sourced from PubChem (CID 67842104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).