C29H39N3O4 — CID 126676935
N-butyl-4-[[(3S,4R)-4-[4-[2-(2-oxopyrrolidin-1-yl)ethoxy]phenyl]piperidin-3-yl]methoxy]benzamide (PubChem CID 126676935) has the molecular formula C29H39N3O4 and a molecular weight of 493.65 g/mol. Its IUPAC name is N-butyl-4-[[(3S,4R)-4-[4-[2-(2-oxopyrrolidin-1-yl)ethoxy]phenyl]piperidin-3-yl]methoxy]benzamide.
| Compound Name | N-butyl-4-[[(3S,4R)-4-[4-[2-(2-oxopyrrolidin-1-yl)ethoxy]phenyl]piperidin-3-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 126676935 |
| Molecular Formula | C29H39N3O4 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | N-butyl-4-[[(3S,4R)-4-[4-[2-(2-oxopyrrolidin-1-yl)ethoxy]phenyl]piperidin-3-yl]methoxy]benzamide |
| SMILES | CCCCNC(=O)c1ccc(OC[C@@H]2CNCC[C@H]2c2ccc(OCCN3CCCC3=O)cc2)cc1 |
| InChI | InChI=1S/C29H39N3O4/c1-2-3-15-31-29(34)23-8-12-26(13-9-23)36-21-24-20-30-16-14-27(24)22-6-10-25(11-7-22)35-19-18-32-17-4-5-28(32)33/h6-13,24,27,30H,2-5,14-21H2,1H3,(H,31,34)/t24-,27-/m0/s1 |
| InChIKey | HEBLFBUDGMKHAO-IGKIAQTJSA-N |
| XLogP | 3.99 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|