C23H23F2N3O5 — CID 68531476
but-2-enedioic acid;5-fluoro-1-(2-fluorophenyl)-3-[[(3S)-piperidin-3-yl]methoxy]indazole (PubChem CID 68531476) has the molecular formula C23H23F2N3O5 and a molecular weight of 459.45 g/mol. Its IUPAC name is but-2-enedioic acid;5-fluoro-1-(2-fluorophenyl)-3-[[(3S)-piperidin-3-yl]methoxy]indazole.
| Compound Name | but-2-enedioic acid;5-fluoro-1-(2-fluorophenyl)-3-[[(3S)-piperidin-3-yl]methoxy]indazole |
|---|---|
| PubChem CID | 68531476 |
| Molecular Formula | C23H23F2N3O5 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | but-2-enedioic acid;5-fluoro-1-(2-fluorophenyl)-3-[[(3S)-piperidin-3-yl]methoxy]indazole |
| SMILES | Fc1ccc2c(c1)c(OC[C@H]1CCCNC1)nn2-c1ccccc1F.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H19F2N3O.C4H4O4/c20-14-7-8-17-15(10-14)19(25-12-13-4-3-9-22-11-13)23-24(17)18-6-2-1-5-16(18)21;5-3(6)1-2-4(7)8/h1-2,5-8,10,13,22H,3-4,9,11-12H2;1-2H,(H,5,6)(H,7,8)/t13-;/m0./s1 |
| InChIKey | NFMKGDYROGMMND-ZOWNYOTGSA-N |
| XLogP | 3.39 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|