C19H20ClF2N3O — CID 68533546
5-fluoro-1-(4-fluorophenyl)-3-[[(3S)-piperidin-3-yl]methoxy]indazole;hydrochloride (PubChem CID 68533546) has the molecular formula C19H20ClF2N3O and a molecular weight of 379.84 g/mol. Its IUPAC name is 5-fluoro-1-(4-fluorophenyl)-3-[[(3S)-piperidin-3-yl]methoxy]indazole;hydrochloride.
| Compound Name | 5-fluoro-1-(4-fluorophenyl)-3-[[(3S)-piperidin-3-yl]methoxy]indazole;hydrochloride |
|---|---|
| PubChem CID | 68533546 |
| Molecular Formula | C19H20ClF2N3O |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 5-fluoro-1-(4-fluorophenyl)-3-[[(3S)-piperidin-3-yl]methoxy]indazole;hydrochloride |
| SMILES | Cl.Fc1ccc(-n2nc(OC[C@H]3CCCNC3)c3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C19H19F2N3O.ClH/c20-14-3-6-16(7-4-14)24-18-8-5-15(21)10-17(18)19(23-24)25-12-13-2-1-9-22-11-13;/h3-8,10,13,22H,1-2,9,11-12H2;1H/t13-;/m0./s1 |
| InChIKey | RCOFHMDIRJWEMK-ZOWNYOTGSA-N |
| XLogP | 4.10 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |