C19H19F2N3O — CID 11631528
1-(2,6-difluorophenyl)-3-[[(3S)-piperidin-3-yl]methoxy]indazole (PubChem CID 11631528) has the molecular formula C19H19F2N3O and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[[(3S)-piperidin-3-yl]methoxy]indazole.
| Compound Name | 1-(2,6-difluorophenyl)-3-[[(3S)-piperidin-3-yl]methoxy]indazole |
|---|---|
| PubChem CID | 11631528 |
| Molecular Formula | C19H19F2N3O |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[[(3S)-piperidin-3-yl]methoxy]indazole |
| SMILES | Fc1cccc(F)c1-n1nc(OC[C@H]2CCCNC2)c2ccccc21 |
| InChI | InChI=1S/C19H19F2N3O/c20-15-7-3-8-16(21)18(15)24-17-9-2-1-6-14(17)19(23-24)25-12-13-5-4-10-22-11-13/h1-3,6-9,13,22H,4-5,10-12H2/t13-/m0/s1 |
| InChIKey | ODSOVFPQIASKTR-ZDUSSCGKSA-N |
| XLogP | 3.68 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |