C18H17F2N3O2 — CID 25120226
2-[[1-(3,4-difluorophenyl)indazol-3-yl]oxymethyl]morpholine (PubChem CID 25120226) has the molecular formula C18H17F2N3O2 and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-[[1-(3,4-difluorophenyl)indazol-3-yl]oxymethyl]morpholine.
| Compound Name | 2-[[1-(3,4-difluorophenyl)indazol-3-yl]oxymethyl]morpholine |
|---|---|
| PubChem CID | 25120226 |
| Molecular Formula | C18H17F2N3O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[[1-(3,4-difluorophenyl)indazol-3-yl]oxymethyl]morpholine |
| SMILES | Fc1ccc(-n2nc(OCC3CNCCO3)c3ccccc32)cc1F |
| InChI | InChI=1S/C18H17F2N3O2/c19-15-6-5-12(9-16(15)20)23-17-4-2-1-3-14(17)18(22-23)25-11-13-10-21-7-8-24-13/h1-6,9,13,21H,7-8,10-11H2 |
| InChIKey | HHCVWJISGXXXOF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |