C16H19F2N3O2 — CID 150930159
2-[2-[[1-(3,4-difluorophenyl)pyrazol-3-yl]methoxy]ethyl]morpholine (PubChem CID 150930159) has the molecular formula C16H19F2N3O2 and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-[2-[[1-(3,4-difluorophenyl)pyrazol-3-yl]methoxy]ethyl]morpholine.
| Compound Name | 2-[2-[[1-(3,4-difluorophenyl)pyrazol-3-yl]methoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 150930159 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-[2-[[1-(3,4-difluorophenyl)pyrazol-3-yl]methoxy]ethyl]morpholine |
| SMILES | Fc1ccc(-n2ccc(COCCC3CNCCO3)n2)cc1F |
| InChI | InChI=1S/C16H19F2N3O2/c17-15-2-1-13(9-16(15)18)21-6-3-12(20-21)11-22-7-4-14-10-19-5-8-23-14/h1-3,6,9,14,19H,4-5,7-8,10-11H2 |
| InChIKey | LFVZSTHUHQOROB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|