C12H16F2N2O — CID 116941595
1-(3,4-difluorophenyl)-2-morpholin-2-ylethanamine (PubChem CID 116941595) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-morpholin-2-ylethanamine.
| Compound Name | 1-(3,4-difluorophenyl)-2-morpholin-2-ylethanamine |
|---|---|
| PubChem CID | 116941595 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-morpholin-2-ylethanamine |
| SMILES | NC(CC1CNCCO1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H16F2N2O/c13-10-2-1-8(5-11(10)14)12(15)6-9-7-16-3-4-17-9/h1-2,5,9,12,16H,3-4,6-7,15H2 |
| InChIKey | IBACQLOGLXZHRJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |