C11H13F2NO2S — CID 112741743
2-[(3,4-difluorophenyl)sulfinylmethyl]morpholine (PubChem CID 112741743) has the molecular formula C11H13F2NO2S and a molecular weight of 261.29 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)sulfinylmethyl]morpholine.
| Compound Name | 2-[(3,4-difluorophenyl)sulfinylmethyl]morpholine |
|---|---|
| PubChem CID | 112741743 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-[(3,4-difluorophenyl)sulfinylmethyl]morpholine |
| SMILES | O=S(CC1CNCCO1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H13F2NO2S/c12-10-2-1-9(5-11(10)13)17(15)7-8-6-14-3-4-16-8/h1-2,5,8,14H,3-4,6-7H2 |
| InChIKey | VEAREDYNKYCVKK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |