C12H15F2NO — CID 81268520
3-[(2,6-difluorophenoxy)methyl]piperidine (PubChem CID 81268520) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is 3-[(2,6-difluorophenoxy)methyl]piperidine.
| Compound Name | 3-[(2,6-difluorophenoxy)methyl]piperidine |
|---|---|
| PubChem CID | 81268520 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-[(2,6-difluorophenoxy)methyl]piperidine |
| SMILES | Fc1cccc(F)c1OCC1CCCNC1 |
| InChI | InChI=1S/C12H15F2NO/c13-10-4-1-5-11(14)12(10)16-8-9-3-2-6-15-7-9/h1,4-5,9,15H,2-3,6-8H2 |
| InChIKey | AFZMGHDNGRSTLI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |