C19H18F3N3O — CID 68534726
1-(2,6-difluorophenyl)-4-fluoro-3-(piperidin-3-ylmethoxy)indazole (PubChem CID 68534726) has the molecular formula C19H18F3N3O and a molecular weight of 361.37 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-4-fluoro-3-(piperidin-3-ylmethoxy)indazole.
| Compound Name | 1-(2,6-difluorophenyl)-4-fluoro-3-(piperidin-3-ylmethoxy)indazole |
|---|---|
| PubChem CID | 68534726 |
| Molecular Formula | C19H18F3N3O |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-(2,6-difluorophenyl)-4-fluoro-3-(piperidin-3-ylmethoxy)indazole |
| SMILES | Fc1cccc(F)c1-n1nc(OCC2CCCNC2)c2c(F)cccc21 |
| InChI | InChI=1S/C19H18F3N3O/c20-13-5-2-8-16-17(13)19(26-11-12-4-3-9-23-10-12)24-25(16)18-14(21)6-1-7-15(18)22/h1-2,5-8,12,23H,3-4,9-11H2 |
| InChIKey | LJQXVLCYMTWVJF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |