About difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine
difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine (PubChem CID 166104221) has the molecular formula C13H18F3NO
and a molecular weight of 261.29 g/mol. Its IUPAC name is difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine.
Molecular Properties
| Compound Name | difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine |
| PubChem CID | 166104221 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine |
| SMILES | FCF.Fc1ccccc1OCC1CCCNC1 |
| InChI | InChI=1S/C12H16FNO.CH2F2/c13-11-5-1-2-6-12(11)15-9-10-4-3-7-14-8-10;2-1-3/h1-2,5-6,10,14H,3-4,7-9H2;1H2 |
| InChIKey | UCZKZFBTBDQSOA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine?
The IUPAC name of difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine (CID 166104221) is difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine.
What is the SMILES notation for difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine?
The canonical SMILES for difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine is FCF.Fc1ccccc1OCC1CCCNC1.
What is the InChIKey of difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine?
The InChIKey is UCZKZFBTBDQSOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO.CH2F2/c13-11-5-1-2-6-12(11)15-9-10-4-3-7-14-8-10;2-1-3/h1-2,5-6,10,14H,3-4,7-9H2;1H2.
What are the key properties of difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine?
difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine has a molecular weight of 261.29 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethane;3-[(2-fluorophenoxy)methyl]piperidine is sourced from PubChem (CID 166104221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).