C20H22ClF2N3O — CID 68570920
5-fluoro-1-(2-fluorophenyl)-3-[(4-methylpiperidin-4-yl)methoxy]indazole;hydron;chloride (PubChem CID 68570920) has the molecular formula C20H22ClF2N3O and a molecular weight of 393.87 g/mol. Its IUPAC name is 5-fluoro-1-(2-fluorophenyl)-3-[(4-methylpiperidin-4-yl)methoxy]indazole;hydron;chloride.
| Compound Name | 5-fluoro-1-(2-fluorophenyl)-3-[(4-methylpiperidin-4-yl)methoxy]indazole;hydron;chloride |
|---|---|
| PubChem CID | 68570920 |
| Molecular Formula | C20H22ClF2N3O |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 5-fluoro-1-(2-fluorophenyl)-3-[(4-methylpiperidin-4-yl)methoxy]indazole;hydron;chloride |
| SMILES | CC1(COc2nn(-c3ccccc3F)c3ccc(F)cc23)CCNCC1.[Cl-].[H+] |
| InChI | InChI=1S/C20H21F2N3O.ClH/c1-20(8-10-23-11-9-20)13-26-19-15-12-14(21)6-7-17(15)25(24-19)18-5-3-2-4-16(18)22;/h2-7,12,23H,8-11,13H2,1H3;1H |
| InChIKey | LFEBVPNJMCMCEB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |