C21H12Cl2O7 — CID 87781539
8-chloro-3-(6-chloro-4-hydroxy-2-oxochromen-3-yl)-2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one (PubChem CID 87781539) has the molecular formula C21H12Cl2O7 and a molecular weight of 447.23 g/mol. Its IUPAC name is 8-chloro-3-(6-chloro-4-hydroxy-2-oxochromen-3-yl)-2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one.
| Compound Name | 8-chloro-3-(6-chloro-4-hydroxy-2-oxochromen-3-yl)-2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 87781539 |
| Molecular Formula | C21H12Cl2O7 |
| Molecular Weight | 447.23 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 8-chloro-3-(6-chloro-4-hydroxy-2-oxochromen-3-yl)-2-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one |
| SMILES | COC1Oc2c(c(=O)oc3ccc(Cl)cc23)C1c1c(O)c2cc(Cl)ccc2oc1=O |
| InChI | InChI=1S/C21H12Cl2O7/c1-27-21-14(15-17(24)10-6-8(22)2-4-12(10)28-19(15)25)16-18(30-21)11-7-9(23)3-5-13(11)29-20(16)26/h2-7,14,21,24H,1H3 |
| InChIKey | FVOBCWADORGXNL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.23 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|