C24H20O9 — CID 87781506
2-ethoxy-3-(4-hydroxy-6-methoxy-2-oxochromen-3-yl)-8-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one (PubChem CID 87781506) has the molecular formula C24H20O9 and a molecular weight of 452.42 g/mol. Its IUPAC name is 2-ethoxy-3-(4-hydroxy-6-methoxy-2-oxochromen-3-yl)-8-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one.
| Compound Name | 2-ethoxy-3-(4-hydroxy-6-methoxy-2-oxochromen-3-yl)-8-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 87781506 |
| Molecular Formula | C24H20O9 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-ethoxy-3-(4-hydroxy-6-methoxy-2-oxochromen-3-yl)-8-methoxy-2,3-dihydrofuro[3,2-c]chromen-4-one |
| SMILES | CCOC1Oc2c(c(=O)oc3ccc(OC)cc23)C1c1c(O)c2cc(OC)ccc2oc1=O |
| InChI | InChI=1S/C24H20O9/c1-4-30-24-17(18-20(25)13-9-11(28-2)5-7-15(13)31-22(18)26)19-21(33-24)14-10-12(29-3)6-8-16(14)32-23(19)27/h5-10,17,24-25H,4H2,1-3H3 |
| InChIKey | KAOXUSOHMKCJFW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|