C23H22O8 — CID 96544767
ethyl (2R,3R)-4-oxo-3-(2,4,6-trimethoxyphenyl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate (PubChem CID 96544767) has the molecular formula C23H22O8 and a molecular weight of 426.42 g/mol. Its IUPAC name is ethyl (2R,3R)-4-oxo-3-(2,4,6-trimethoxyphenyl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate.
| Compound Name | ethyl (2R,3R)-4-oxo-3-(2,4,6-trimethoxyphenyl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 96544767 |
| Molecular Formula | C23H22O8 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | ethyl (2R,3R)-4-oxo-3-(2,4,6-trimethoxyphenyl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Oc2c(c(=O)oc3ccccc23)[C@H]1c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C23H22O8/c1-5-29-23(25)21-18(17-15(27-3)10-12(26-2)11-16(17)28-4)19-20(31-21)13-8-6-7-9-14(13)30-22(19)24/h6-11,18,21H,5H2,1-4H3/t18-,21-/m1/s1 |
| InChIKey | PZMYDAOOSXCOMY-WIYYLYMNSA-N |
| XLogP | 3.27 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|