C24H19NO7 — CID 71754256
ethyl 3-(7-methoxy-2-oxo-1H-quinolin-3-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate (PubChem CID 71754256) has the molecular formula C24H19NO7 and a molecular weight of 433.42 g/mol. Its IUPAC name is ethyl 3-(7-methoxy-2-oxo-1H-quinolin-3-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate.
| Compound Name | ethyl 3-(7-methoxy-2-oxo-1H-quinolin-3-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 71754256 |
| Molecular Formula | C24H19NO7 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | ethyl 3-(7-methoxy-2-oxo-1H-quinolin-3-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
| SMILES | CCOC(=O)C1Oc2c(c(=O)oc3ccccc23)C1c1cc2ccc(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C24H19NO7/c1-3-30-24(28)21-18(15-10-12-8-9-13(29-2)11-16(12)25-22(15)26)19-20(32-21)14-6-4-5-7-17(14)31-23(19)27/h4-11,18,21H,3H2,1-2H3,(H,25,26) |
| InChIKey | YRGLOKCJCQXPLB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|