C24H19NO6 — CID 96544607
ethyl (2R,3R)-3-(1-methyl-2-oxoquinolin-3-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate (PubChem CID 96544607) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is ethyl (2R,3R)-3-(1-methyl-2-oxoquinolin-3-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate.
| Compound Name | ethyl (2R,3R)-3-(1-methyl-2-oxoquinolin-3-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 96544607 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | ethyl (2R,3R)-3-(1-methyl-2-oxoquinolin-3-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Oc2c(c(=O)oc3ccccc23)[C@H]1c1cc2ccccc2n(C)c1=O |
| InChI | InChI=1S/C24H19NO6/c1-3-29-24(28)21-18(15-12-13-8-4-6-10-16(13)25(2)22(15)26)19-20(31-21)14-9-5-7-11-17(14)30-23(19)27/h4-12,18,21H,3H2,1-2H3/t18-,21-/m1/s1 |
| InChIKey | RYMCCCGKAGFXQP-WIYYLYMNSA-N |
| XLogP | 3.10 |
| TPSA | 87.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|