C23H17NO5 — CID 96544696
ethyl (2R,3S)-4-oxo-3-quinolin-6-yl-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate (PubChem CID 96544696) has the molecular formula C23H17NO5 and a molecular weight of 387.39 g/mol. Its IUPAC name is ethyl (2R,3S)-4-oxo-3-quinolin-6-yl-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate.
| Compound Name | ethyl (2R,3S)-4-oxo-3-quinolin-6-yl-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 96544696 |
| Molecular Formula | C23H17NO5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | ethyl (2R,3S)-4-oxo-3-quinolin-6-yl-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Oc2c(c(=O)oc3ccccc23)[C@@H]1c1ccc2ncccc2c1 |
| InChI | InChI=1S/C23H17NO5/c1-2-27-23(26)21-18(14-9-10-16-13(12-14)6-5-11-24-16)19-20(29-21)15-7-3-4-8-17(15)28-22(19)25/h3-12,18,21H,2H2,1H3/t18-,21+/m0/s1 |
| InChIKey | OBXGNYNHWMFVBS-GHTZIAJQSA-N |
| XLogP | 3.80 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|