C19H16O6 — CID 71754395
ethyl 3-(5-methylfuran-2-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate (PubChem CID 71754395) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is ethyl 3-(5-methylfuran-2-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate.
| Compound Name | ethyl 3-(5-methylfuran-2-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 71754395 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | ethyl 3-(5-methylfuran-2-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
| SMILES | CCOC(=O)C1Oc2c(c(=O)oc3ccccc23)C1c1ccc(C)o1 |
| InChI | InChI=1S/C19H16O6/c1-3-22-19(21)17-14(13-9-8-10(2)23-13)15-16(25-17)11-6-4-5-7-12(11)24-18(15)20/h4-9,14,17H,3H2,1-2H3 |
| InChIKey | TXSKKCHUOLKEDH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|